Գունանյութ դեղին 151-Corimax Yellow H4G
Technical parameters of Pigment yellow 151
| Գույնի ցուցիչ No. | Գունանյութ դեղին 151 |
| Ապրանքային անուն | Corimax Yellow H4G |
| Ապրանքի կատեգորիա | Օրգանական գունանյութ |
| CAS համարը | 31837-42-0 |
| ԵՄ համարը | 250-830-4 |
| Քիմիական ընտանիք | Մոնո ազո |
| Մոլեկուլային քաշը | 381.34 |
| Մոլեկուլային բանաձև | C18H15N5O5 |
| PH արժեք | 7 |
| Խտությունը | 1.6 |
| Նավթի կլանում (մլ / 100 գ)% | 45 |
| Լույսի ամրություն (ծածկույթ) | 6-7 |
| Heերմակայունություն (ծածկույթ) | 200 |
| Լույսի ամրություն (պլաստիկ) | 7-8 |
| Heերմակայունություն (պլաստիկ) | 260 |
| Waterրի դիմադրություն | 5 |
| Նավթի դիմադրություն | 5 |
| Թթվային դիմադրություն | 5 |
| Ալկալի դիմադրություն | 5 |
Գույն | ![]() |
| Գունավոր բաշխում |
Մոլեկուլային կառուցվածքը.

Դիմում
Recommended for automotive paints, architectural coatings, coil coatings, industrial paints, powder coatings, printing pastes, PVC, rubber, PS, PP, PE, PU, water based inks, solvent inks, UV inks.
Կարող է օգտագործվել օֆսեթային թանաքներով:
Առնչվող տեղեկություններ
Pigment yellow 151 gives a hue that is greener than CI Pigment Yellow 154 and redder than Pigment Yellow 175. The hue angle is 97.4 degrees (1 / 3SD). The specific surface area of Hostaperm Yellow H4G is 23m2 / g, which has good hiding power. The fastness is excellent. The coloring sample of alkyd trinitrile resin is exposed to Florida for 1 year. The weather fastness has a grade 5 gray card, and the dilute color (1; 3TiO2) is still grade 4; 1/3 The heat resistance stability of HDPE in standard depth is 260 ° C / 5min; it is suitable for high-end industrial coatings, automotive primers (OEM), and can be combined with phthalocyanines and inorganic pigments, and can also be used for printing polyester laminated plastic films Ink coloring.
aliases:13980; Benzoic acid, 2-(2-(1-(((2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)amino)carbonyl)-2-oxopropyl)diazenyl)-; pigment yellow 151; 2-[[1-[[(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)amino]carbonyl]-2-oxopropyl]azo]benzoic acid; C.I. 13980; fast yellow h4g; 2-[2-OXO-1-[(2-OXO-1,3-DIHYDROBENZOIMIDAZOL-5-YL)CARBAMOY; PROPYL]DIAZENYLBENZOIC ACID; Benzoic acid, 2-1-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)aminocarbonyl-2-oxopropylazo-; BENZIMIDAZOLONE YELLOS H4G; Benzimidazolone Yellow H4G(Pigment Yellow 151); 2-[(E)-{1,3-dioxo-1-[(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)amino]butan-2-yl}diazenyl]benzoic acid; 2-[2-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamoyl]propyl]azobenzoic acid.
IUPAC Name: 2-[[1,3-dioxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butan-2-yl]diazenyl]benzoic acid
InChI : InChI=1S/C18H15N5O5/c1-9(24)15(23-22-12-5-3-2-4-11(12)17(26)27)16(25)19-10-6-7-13-14(8-10)21-18(28)20-13/h2-8,15H,1H3,(H,19,25)(H,26,27)(H2,20,21,28)
InChIKey: YMFWVWDPPIWORA-UHFFFAOYSA-N
Canonical SMILES: CC(=O)C(C(=O)NC1=CC2=C(C=C1)NC(=O)N2)N=NC3=CC=CC=C3C(=O)O
Քիմիական և ֆիզիկական հատկություններ
Հաշվարկված հատկություններ
| Սեփականության անվանումը | Գույքի արժեքը |
| Մոլեկուլային քաշը | 381.3 g/mol |
| XLogP3-AA | 1.7 |
| Ջրածնային կապի դոնորների թիվը | 4 |
| Ջրածնի կապի ընդունիչների թիվը | 7 |
| Պտտվող պարտատոմսերի հաշվարկ | 6 |
| Ճշգրիտ պատարագ | 381.10731860 g/mol |
| Մոնոիզոտոպային զանգված | 381.10731860 g/mol |
| Տոպոլոգիական բևեռային մակերեսի տարածք | 149Ų |
| Ծանր ատոմների հաշվարկ | 28 |
| Պաշտոնական վճար | 0 |
| Բարդություն | 681 |
| Իզոտոպների ատոմային հաշվարկ | 0 |
| Սահմանված ատոմային ստերեոկենտրոնի հաշվարկ | 0 |
| Չսահմանված ատոմային ստերեոկենտրոնի հաշվարկ | 1 |
| Սահմանված Պարտատոմսերի ստերեոկենտրոնի քանակ | 0 |
| Չսահմանված պարտատոմսերի ստերեոկենտրոնի քանակ | 0 |
| Covalently-Bonded Unit Count | 1 |
| Բաղադրությունը կանոնականացված է | Այո՛ |
Handling and storage:
Handling
Advice on protection against fire and explosion
Keep away from sources of ignition
Avoid formation of dust
Take precautionary measures against electrostatic loading
Storage
Be kept in a ventilated, cool and dry place, it should be also avoided to contact with acid material and expose to air. Keep container dry
Տեսանյութ.











