Pigment Orange 16 – Corimax Orange BRN
Pigment Orange 16 is a bright, strong orange pigment widely used in coatings, inks, paints, and plastics. Known for its excellent lightfastness, weather resistance, and chemical stability, it delivers vibrant and long-lasting color, making it ideal for both indoor and outdoor applications. This pigment provides good opacity and color strength, ensuring a rich orange hue that maintains its vibrancy over time. Pigment Orange 16 is often chosen for industrial coatings, automotive finishes, and packaging, where durability and color consistency are essential. It is also valued for its non-toxic properties and environmental safety in various manufacturing sectors.
Technical parameters of Pigment orange 16
| Գույնի ցուցիչ No. | Գունանյութ նարնջագույն 16 |
| Ապրանքային անուն | Corimax Orange BRN |
| Ապրանքի կատեգորիա | Օրգանական գունանյութ |
| CAS համարը | 3520-72-7 |
| ԵՄ համարը | 222-530-3 |
| Քիմիական ընտանիք | Դիսազո |
| Մոլեկուլային քաշը | 623.49 |
| Մոլեկուլային բանաձև | C32H24CI2N8O2 |
| PH արժեք | 7 |
| Խտությունը | 1.5 |
| Նավթի կլանում (մլ / 100 գ)% | 35 |
| Լույսի ամրություն (ծածկույթ) | 5 |
| Heերմակայունություն (ծածկույթ) | 180 |
| Լույսի ամրություն (պլաստիկ) | 6 |
| Heերմակայունություն (պլաստիկ) | 200 |
| Waterրի դիմադրություն | 5 |
| Նավթի դիմադրություն | 4 |
| Թթվային դիմադրություն | 4 |
| Ալկալի դիմադրություն | 4 |
Գույն | ![]() |
| Գունավոր բաշխում |
Դիմում
Առաջարկվում է փոշու ծածկույթների, մածուկների տպման, PVC, ռետինե, PP, PE, օֆսեթային թանաքների, ջրի վրա հիմնված թանաքների, լուծիչների թանաքների համար
Առաջարկվում է PS, PU, UV Inks համար:
Առնչվող տեղեկություններ
There are 36 types of pigment commercial dosage forms, and they still have a certain market in Europe, America and Japan. It gives a yellowish orange color, which is significantly redder than the C.I. pigment orange 13 and pigment orange 34. Mainly used in printing inks, and can be used to adjust the color light of C.I. Pigment Yellow 12. Resinized formulations have high transparency, but poor fluidity. Due to their poor fastness properties, they are mostly used for packaging inks with high transparency and low cost.
Ալիազներ: 21160; C.I.Pigment Orange 16; P.O.16; Dianisidine Orange; 2,2'-[[3,3'-dimethyl(1,1'-biphenyl)-4,4'-diyl]bis(azo)]bis(3-oxo-N-phenyl-Butanamide]; 2,2'-[(3,3'-dimethoxybiphenyl-4,4'-diyl)di(E)diazene-2,1-diyl]bis(3-oxo-N-phenylbutanamide)
InChI InChI=1/C34H32N6O6/c1-21(41)31(33(43)35-25-11-7-5-8-12-25)39-37-27-17-15-23(19-29(27)45-3)24-16-18-28(30(20-24)46-4)38-40-32(22(2)42)34(44)36-26-13-9-6-10-14-26/h5-20,31-32H,1-4H3,(H,35,43)(H,36,44)/b39-37+,40-38+
Մոլեկուլային կառուցվածքը.
Ֆիզիկական և քիմիական հատկություններ
Solubility: Do not dissolve in water and ethanol, dissolve in concentrated sulfuric acid, and show orange precipitate after dilution.
Hue or light: red light orange
Հարաբերական խտությունը ՝ 1.28-1.51
Bulk density / (lb / gal): 10.6-12.5
pH value / (10% slurry): 5.0-7.5
Oil absorption / (g / 100g): 28-54
Ծածկող ուժը `կիսաթափանցիկ
Structural Identifiers
IUPAC Name: 2,2'-[(3,3'-Dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(diazene-2,1-diyl)]bis(3-oxo-N-phenylbutanamide)
SMILES: COC1=CC(=CC=C1N=NC(C(C)=O)C(=O)NC1=CC=CC=C1)C1=CC(OC)=C(C=C1)N=NC(C(C)=O)C(=O)NC1=CC=CC=C1
InChI String: InChI=1/C34H32N6O6/c1-21(41)31(33(43)35-25-11-7-5-8-12-25)39-37-27-17-15-23(19-29(27)45-3)24-16-18-28(30(20-24)46-4)38-40-32(22(2)42)34(44)36-26-13-9-6-10-14-26/h5-20,31-32H,1-4H3,(H,35,43)(H,36,44)
InChIKey: DMPXHEMGDYKSFL-UHFFFAOYSA-N
Հաշվարկված հատկություններ
| Սեփականության անվանումը | Գույքի արժեքը |
| Մոլեկուլային քաշը | 620.7 g/mol |
| XLogP3-AA | 6.7 |
| Ջրածնային կապի դոնորների թիվը | 2 |
| Ջրածնի կապի ընդունիչների թիվը | 10 |
| Պտտվող պարտատոմսերի հաշվարկ | 13 |
| Ճշգրիտ պատարագ | 620.23833276 Da |
| Մոնոիզոտոպային զանգված | 620.23833276 Da |
| Տոպոլոգիական բևեռային մակերեսի տարածք | 160 Ų |
| Ծանր ատոմների հաշվարկ | 46 |
| Պաշտոնական վճար | 0 |
| Բարդություն | 1000 |
| Իզոտոպների ատոմային հաշվարկ | 0 |
| Սահմանված ատոմային ստերեոկենտրոնի հաշվարկ | 0 |
| Չսահմանված ատոմային ստերեոկենտրոնի հաշվարկ | 2 |
| Սահմանված Պարտատոմսերի ստերեոկենտրոնի քանակ | 0 |
| Չսահմանված պարտատոմսերի ստերեոկենտրոնի քանակ | 0 |
| Covalently-Bonded Unit Count | 1 |
| Բաղադրությունը կանոնականացված է | Այո՛ |











